| MW | 257.23 | Smiles | [Se]=C1SSC(C2=CC=CC=C2)=C1 |
|---|---|---|---|
| MF | C9H6S2Se | Melting point | |
| Purity | Boiling point | ||
| CAS Number | 35141-92-5 | Storage | |
| Cat. No. | KL-0035141-925 | Sell-by date | |
| Transportation Conditions | Packing Condition | ||
| InChI | InChI Key |
The technical data provided above is for guidance only. For batch specific data refer to the Certificate of Analysis.
| GHS | |
|---|---|
| Warning language | |
| Class | |
| Warning statement | |
| UNub | |
| Hazard Statement | |
| Packing Group |
The technical data provided above is for guidance only. For batch specific data refer to the Certificate of Analysis.
anna.chen@serpharm.com Anna Chen (Ms.)
WeChat
