| MW | Smiles | C(N[C@H](C(N[C@@H](C(N[C@H](C(N[C@@H]1C(=O)N[C@H](CCCN)C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@H](CC2=CC=CC=C2)C(=O)N[C@@H](CC3=CN=CN3)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCC1)[H])=O)C(C)C)=O)CCC(O)=O)=O)CC(C)C)(=O)[C@H]4N=C([C@H]([C@H](CC)C)N)SC4 | |
|---|---|---|---|
| MF | C65H101N17O16S | Melting point | |
| Purity | Boiling point | ||
| CAS Number | 57762-78-4 | Storage | |
| Cat. No. | KL-0057762-784 | Sell-by date | |
| Transportation Conditions | Packing Condition | ||
| InChI | InChI Key |
The technical data provided above is for guidance only. For batch specific data refer to the Certificate of Analysis.
| GHS | |
|---|---|
| Warning language | |
| Class | |
| Warning statement | |
| UNub | |
| Hazard Statement | |
| Packing Group |
The technical data provided above is for guidance only. For batch specific data refer to the Certificate of Analysis.
anna.chen@serpharm.com Anna Chen (Ms.)
WeChat
